C13H11N3S — CID 63970380
quinolin-6-yl(1,3-thiazol-2-yl)methanamine (PubChem CID 63970380) has the molecular formula C13H11N3S and a molecular weight of 241.32 g/mol. Its IUPAC name is quinolin-6-yl(1,3-thiazol-2-yl)methanamine.
| Compound Name | quinolin-6-yl(1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 63970380 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | quinolin-6-yl(1,3-thiazol-2-yl)methanamine |
| SMILES | NC(c1ccc2ncccc2c1)c1nccs1 |
| InChI | InChI=1S/C13H11N3S/c14-12(13-16-6-7-17-13)10-3-4-11-9(8-10)2-1-5-15-11/h1-8,12H,14H2 |
| InChIKey | GQJXSQWMKGCNIG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |