C12H10ClNOS — CID 82024303
3-(3-chlorophenyl)-2-(1,3-thiazol-2-yl)propanal (PubChem CID 82024303) has the molecular formula C12H10ClNOS and a molecular weight of 251.74 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-(1,3-thiazol-2-yl)propanal.
| Compound Name | 3-(3-chlorophenyl)-2-(1,3-thiazol-2-yl)propanal |
|---|---|
| PubChem CID | 82024303 |
| Molecular Formula | C12H10ClNOS |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 3-(3-chlorophenyl)-2-(1,3-thiazol-2-yl)propanal |
| SMILES | O=CC(Cc1cccc(Cl)c1)c1nccs1 |
| InChI | InChI=1S/C12H10ClNOS/c13-11-3-1-2-9(7-11)6-10(8-15)12-14-4-5-16-12/h1-5,7-8,10H,6H2 |
| InChIKey | PHEDFSIJEUKENZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|