C28H23F3O3S — CID 69259754
(triphenyl-λ4-sulfanyl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 69259754) has the molecular formula C28H23F3O3S and a molecular weight of 496.55 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | (triphenyl-λ4-sulfanyl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 69259754 |
| Molecular Formula | C28H23F3O3S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(C(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H23F3O3S/c1-33-27(28(29,30)31,22-14-6-2-7-15-22)26(32)34-35(23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25/h2-21H,1H3 |
| InChIKey | WAPPNEUXRUWKGG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |