C15H10F4O — CID 126699875
2-[4-(difluoromethyl)phenyl]-2,2-difluoro-1-phenylethanone (PubChem CID 126699875) has the molecular formula C15H10F4O and a molecular weight of 282.24 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)phenyl]-2,2-difluoro-1-phenylethanone.
| Compound Name | 2-[4-(difluoromethyl)phenyl]-2,2-difluoro-1-phenylethanone |
|---|---|
| PubChem CID | 126699875 |
| Molecular Formula | C15H10F4O |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[4-(difluoromethyl)phenyl]-2,2-difluoro-1-phenylethanone |
| SMILES | O=C(c1ccccc1)C(F)(F)c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C15H10F4O/c16-14(17)11-6-8-12(9-7-11)15(18,19)13(20)10-4-2-1-3-5-10/h1-9,14H |
| InChIKey | WSZMJHYISLFMGH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |