C26H32O7 — CID 15156922
2,2-bis(2-hydroxy-3-prop-2-enoxypropoxy)-1,2-diphenylethanone (PubChem CID 15156922) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2,2-bis(2-hydroxy-3-prop-2-enoxypropoxy)-1,2-diphenylethanone.
| Compound Name | 2,2-bis(2-hydroxy-3-prop-2-enoxypropoxy)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 15156922 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 2,2-bis(2-hydroxy-3-prop-2-enoxypropoxy)-1,2-diphenylethanone |
| SMILES | C=CCOCC(O)COC(OCC(O)COCC=C)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32O7/c1-3-15-30-17-23(27)19-32-26(22-13-9-6-10-14-22,25(29)21-11-7-5-8-12-21)33-20-24(28)18-31-16-4-2/h3-14,23-24,27-28H,1-2,15-20H2 |
| InChIKey | CNNWAROLEMXKQS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|