C24H22O8 — CID 139918601
bis(prop-2-enyl) 2,3-dibenzoyl-2,3-dihydroxybutanedioate (PubChem CID 139918601) has the molecular formula C24H22O8 and a molecular weight of 438.43 g/mol. Its IUPAC name is bis(prop-2-enyl) 2,3-dibenzoyl-2,3-dihydroxybutanedioate.
| Compound Name | bis(prop-2-enyl) 2,3-dibenzoyl-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 139918601 |
| Molecular Formula | C24H22O8 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | bis(prop-2-enyl) 2,3-dibenzoyl-2,3-dihydroxybutanedioate |
| SMILES | C=CCOC(=O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)OCC=C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22O8/c1-3-15-31-21(27)23(29,19(25)17-11-7-5-8-12-17)24(30,22(28)32-16-4-2)20(26)18-13-9-6-10-14-18/h3-14,29-30H,1-2,15-16H2 |
| InChIKey | QXORNCKRWGDIJE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|