C25H23NO10 — CID 158581864
(2R,3R)-2,3-dibenzoyl-4-ethoxy-2,3-dihydroxy-4-oxobutanoic acid;1H-pyrrole-2-carboxylic acid (PubChem CID 158581864) has the molecular formula C25H23NO10 and a molecular weight of 497.46 g/mol. Its IUPAC name is (2R,3R)-2,3-dibenzoyl-4-ethoxy-2,3-dihydroxy-4-oxobutanoic acid;1H-pyrrole-2-carboxylic acid.
| Compound Name | (2R,3R)-2,3-dibenzoyl-4-ethoxy-2,3-dihydroxy-4-oxobutanoic acid;1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 158581864 |
| Molecular Formula | C25H23NO10 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (2R,3R)-2,3-dibenzoyl-4-ethoxy-2,3-dihydroxy-4-oxobutanoic acid;1H-pyrrole-2-carboxylic acid |
| SMILES | CCOC(=O)[C@](O)(C(=O)c1ccccc1)[C@](O)(C(=O)O)C(=O)c1ccccc1.O=C(O)c1ccc[nH]1 |
| InChI | InChI=1S/C20H18O8.C5H5NO2/c1-2-28-18(25)20(27,16(22)14-11-7-4-8-12-14)19(26,17(23)24)15(21)13-9-5-3-6-10-13;7-5(8)4-2-1-3-6-4/h3-12,26-27H,2H2,1H3,(H,23,24);1-3,6H,(H,7,8)/t19-,20-;/m1./s1 |
| InChIKey | HTIQYXMQJSTHMA-GZJHNZOKSA-N |
| XLogP | 1.58 |
| TPSA | 191.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|