C20H24O5S2 — CID 59816654
1,2-bis[4-(2-hydroxyethylsulfanyl)phenyl]-2,2-dimethoxyethanone (PubChem CID 59816654) has the molecular formula C20H24O5S2 and a molecular weight of 408.54 g/mol. Its IUPAC name is 1,2-bis[4-(2-hydroxyethylsulfanyl)phenyl]-2,2-dimethoxyethanone.
| Compound Name | 1,2-bis[4-(2-hydroxyethylsulfanyl)phenyl]-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 59816654 |
| Molecular Formula | C20H24O5S2 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1,2-bis[4-(2-hydroxyethylsulfanyl)phenyl]-2,2-dimethoxyethanone |
| SMILES | COC(OC)(C(=O)c1ccc(SCCO)cc1)c1ccc(SCCO)cc1 |
| InChI | InChI=1S/C20H24O5S2/c1-24-20(25-2,16-5-9-18(10-6-16)27-14-12-22)19(23)15-3-7-17(8-4-15)26-13-11-21/h3-10,21-22H,11-14H2,1-2H3 |
| InChIKey | MIKUZBAGYACMRC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|