C24H28O7 — CID 145297690
2,2-dimethoxy-1,2-bis[4-[2-(oxiran-2-yl)ethoxy]phenyl]ethanone (PubChem CID 145297690) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is 2,2-dimethoxy-1,2-bis[4-[2-(oxiran-2-yl)ethoxy]phenyl]ethanone.
| Compound Name | 2,2-dimethoxy-1,2-bis[4-[2-(oxiran-2-yl)ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 145297690 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2,2-dimethoxy-1,2-bis[4-[2-(oxiran-2-yl)ethoxy]phenyl]ethanone |
| SMILES | COC(OC)(C(=O)c1ccc(OCCC2CO2)cc1)c1ccc(OCCC2CO2)cc1 |
| InChI | InChI=1S/C24H28O7/c1-26-24(27-2,18-5-9-20(10-6-18)29-14-12-22-16-31-22)23(25)17-3-7-19(8-4-17)28-13-11-21-15-30-21/h3-10,21-22H,11-16H2,1-2H3 |
| InChIKey | KTXVCDCSJZPZQM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|