C40H36O9 — CID 138517299
[4-[2-[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]-1,1-dimethoxy-2-oxoethyl]phenyl] 2-methylprop-2-enoate (PubChem CID 138517299) has the molecular formula C40H36O9 and a molecular weight of 660.72 g/mol. Its IUPAC name is [4-[2-[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]-1,1-dimethoxy-2-oxoethyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]-1,1-dimethoxy-2-oxoethyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138517299 |
| Molecular Formula | C40H36O9 |
| Molecular Weight | 660.72 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | [4-[2-[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]-1,1-dimethoxy-2-oxoethyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(OC)(OC)C(=O)c2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)C)c(OC(=O)C(=C)C)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H36O9/c1-24(2)37(42)47-33-20-18-32(19-21-33)40(45-7,46-8)36(41)30-15-13-28(14-16-30)27-9-11-29(12-10-27)31-17-22-34(48-38(43)25(3)4)35(23-31)49-39(44)26(5)6/h9-23H,1,3,5H2,2,4,6-8H3 |
| InChIKey | QCFMUYAKBUDOCG-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.72 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|