C14H15NO2 — CID 174617791
(4-cyanophenyl) 3,3-dimethyl-2-methylidenebutanoate (PubChem CID 174617791) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (4-cyanophenyl) 3,3-dimethyl-2-methylidenebutanoate.
| Compound Name | (4-cyanophenyl) 3,3-dimethyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 174617791 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (4-cyanophenyl) 3,3-dimethyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)Oc1ccc(C#N)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H15NO2/c1-10(14(2,3)4)13(16)17-12-7-5-11(9-15)6-8-12/h5-8H,1H2,2-4H3 |
| InChIKey | FMQLEWCTWLWJTB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|