About [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate
[3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate (PubChem CID 56974021) has the molecular formula C24H23NO6
and a molecular weight of 421.45 g/mol. Its IUPAC name is [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate |
| PubChem CID | 56974021 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate |
| SMILES | CC(C)(CN)c1cc(OC(=O)c2ccc(O)cc2)cc(OC(=O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C24H23NO6/c1-24(2,14-25)17-11-20(30-22(28)15-3-7-18(26)8-4-15)13-21(12-17)31-23(29)16-5-9-19(27)10-6-16/h3-13,26-27H,14,25H2,1-2H3 |
| InChIKey | DPHAKRJBYPKSLU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate?
The IUPAC name of [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate (CID 56974021) is [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate.
What is the SMILES notation for [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate?
The canonical SMILES for [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate is CC(C)(CN)c1cc(OC(=O)c2ccc(O)cc2)cc(OC(=O)c2ccc(O)cc2)c1.
What is the InChIKey of [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate?
The InChIKey is DPHAKRJBYPKSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO6/c1-24(2,14-25)17-11-20(30-22(28)15-3-7-18(26)8-4-15)13-21(12-17)31-23(29)16-5-9-19(27)10-6-16/h3-13,26-27H,14,25H2,1-2H3.
What are the key properties of [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate?
[3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate has a molecular weight of 421.45 g/mol, XLogP of 3.77, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-amino-2-methylpropan-2-yl)-5-(4-hydroxybenzoyl)oxyphenyl] 4-hydroxybenzoate is sourced from PubChem (CID 56974021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).