C13H13NO5 — CID 57045611
(4-hydroxyphenyl) 3-(2,5-dihydroxypyrrol-1-yl)propanoate (PubChem CID 57045611) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is (4-hydroxyphenyl) 3-(2,5-dihydroxypyrrol-1-yl)propanoate.
| Compound Name | (4-hydroxyphenyl) 3-(2,5-dihydroxypyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 57045611 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (4-hydroxyphenyl) 3-(2,5-dihydroxypyrrol-1-yl)propanoate |
| SMILES | O=C(CCn1c(O)ccc1O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C13H13NO5/c15-9-1-3-10(4-2-9)19-13(18)7-8-14-11(16)5-6-12(14)17/h1-6,15-17H,7-8H2 |
| InChIKey | KKURBAYUVSJHBE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|