C9H11N3O3 — CID 174247627
(4-hydroxyphenyl) 2-(diaminomethylideneamino)acetate (PubChem CID 174247627) has the molecular formula C9H11N3O3 and a molecular weight of 209.21 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2-(diaminomethylideneamino)acetate.
| Compound Name | (4-hydroxyphenyl) 2-(diaminomethylideneamino)acetate |
|---|---|
| PubChem CID | 174247627 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | (4-hydroxyphenyl) 2-(diaminomethylideneamino)acetate |
| SMILES | NC(N)=NCC(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C9H11N3O3/c10-9(11)12-5-8(14)15-7-3-1-6(13)2-4-7/h1-4,13H,5H2,(H4,10,11,12) |
| InChIKey | RYWCPMOPMZWEAN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|