C11H15N7O3 — CID 22086651
[2-[(diaminomethylideneamino)carbamoyl]phenyl] 2-(diaminomethylideneamino)acetate (PubChem CID 22086651) has the molecular formula C11H15N7O3 and a molecular weight of 293.29 g/mol. Its IUPAC name is [2-[(diaminomethylideneamino)carbamoyl]phenyl] 2-(diaminomethylideneamino)acetate.
| Compound Name | [2-[(diaminomethylideneamino)carbamoyl]phenyl] 2-(diaminomethylideneamino)acetate |
|---|---|
| PubChem CID | 22086651 |
| Molecular Formula | C11H15N7O3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | [2-[(diaminomethylideneamino)carbamoyl]phenyl] 2-(diaminomethylideneamino)acetate |
| SMILES | NC(N)=NCC(=O)Oc1ccccc1C(=O)NN=C(N)N |
| InChI | InChI=1S/C11H15N7O3/c12-10(13)16-5-8(19)21-7-4-2-1-3-6(7)9(20)17-18-11(14)15/h1-4H,5H2,(H,17,20)(H4,12,13,16)(H4,14,15,18) |
| InChIKey | YESAZWMWVASRFW-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|