C48H39N3O9 — CID 139812443
(4-phenylphenyl) 3-[2,4,6-trioxo-3,5-bis[3-oxo-3-(4-phenylphenoxy)propyl]-1,3,5-triazinan-1-yl]propanoate (PubChem CID 139812443) has the molecular formula C48H39N3O9 and a molecular weight of 801.85 g/mol. Its IUPAC name is (4-phenylphenyl) 3-[2,4,6-trioxo-3,5-bis[3-oxo-3-(4-phenylphenoxy)propyl]-1,3,5-triazinan-1-yl]propanoate.
| Compound Name | (4-phenylphenyl) 3-[2,4,6-trioxo-3,5-bis[3-oxo-3-(4-phenylphenoxy)propyl]-1,3,5-triazinan-1-yl]propanoate |
|---|---|
| PubChem CID | 139812443 |
| Molecular Formula | C48H39N3O9 |
| Molecular Weight | 801.85 g/mol |
| Exact Mass | 801.27 |
| IUPAC Name | (4-phenylphenyl) 3-[2,4,6-trioxo-3,5-bis[3-oxo-3-(4-phenylphenoxy)propyl]-1,3,5-triazinan-1-yl]propanoate |
| SMILES | O=C(CCn1c(=O)n(CCC(=O)Oc2ccc(-c3ccccc3)cc2)c(=O)n(CCC(=O)Oc2ccc(-c3ccccc3)cc2)c1=O)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C48H39N3O9/c52-43(58-40-22-16-37(17-23-40)34-10-4-1-5-11-34)28-31-49-46(55)50(32-29-44(53)59-41-24-18-38(19-25-41)35-12-6-2-7-13-35)48(57)51(47(49)56)33-30-45(54)60-42-26-20-39(21-27-42)36-14-8-3-9-15-36/h1-27H,28-33H2 |
| InChIKey | IYPONHIIEKZXBI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.85 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|