C35H18F6N2O4 — CID 144993684
1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl] 3-O-[3-fluoro-4-(4-methylphenyl)phenyl] 2-iminopropanedioate (PubChem CID 144993684) has the molecular formula C35H18F6N2O4 and a molecular weight of 644.53 g/mol. Its IUPAC name is 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl] 3-O-[3-fluoro-4-(4-methylphenyl)phenyl] 2-iminopropanedioate.
| Compound Name | 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl] 3-O-[3-fluoro-4-(4-methylphenyl)phenyl] 2-iminopropanedioate |
|---|---|
| PubChem CID | 144993684 |
| Molecular Formula | C35H18F6N2O4 |
| Molecular Weight | 644.53 g/mol |
| Exact Mass | 644.12 |
| IUPAC Name | 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl] 3-O-[3-fluoro-4-(4-methylphenyl)phenyl] 2-iminopropanedioate |
| SMILES | [H]/N=C(\C(=O)Oc1ccc(-c2ccc(C)cc2)c(F)c1)C(=O)Oc1ccc(-c2cc(F)c(-c3cc(F)c(C#N)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C35H18F6N2O4/c1-17-2-4-18(5-3-17)23-8-6-21(14-28(23)38)46-34(44)33(43)35(45)47-22-7-9-24(29(39)15-22)19-10-30(40)32(31(41)11-19)20-12-26(36)25(16-42)27(37)13-20/h2-15,43H,1H3/b43-33+ |
| InChIKey | NGHVUCYFYIUBBR-FXLOMAGBSA-N |
| XLogP | 8.23 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.53 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|