C26H14F4N2O2 — CID 145113470
4-[4-[C-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]carbonimidoyl]oxyphenyl]benzonitrile (PubChem CID 145113470) has the molecular formula C26H14F4N2O2 and a molecular weight of 462.40 g/mol. Its IUPAC name is 4-[4-[C-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]carbonimidoyl]oxyphenyl]benzonitrile.
| Compound Name | 4-[4-[C-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]carbonimidoyl]oxyphenyl]benzonitrile |
|---|---|
| PubChem CID | 145113470 |
| Molecular Formula | C26H14F4N2O2 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 4-[4-[C-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]carbonimidoyl]oxyphenyl]benzonitrile |
| SMILES | [H]/N=C(\Oc1ccc(-c2ccc(C#N)cc2)cc1)Oc1ccc(-c2cc(F)c(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C26H14F4N2O2/c27-22-13-20(9-10-21(22)18-11-23(28)25(30)24(29)12-18)34-26(32)33-19-7-5-17(6-8-19)16-3-1-15(14-31)2-4-16/h1-13,32H/b32-26+ |
| InChIKey | HZWZSNXOOTVOGA-HMZBKAONSA-N |
| XLogP | 6.84 |
| TPSA | 66.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|