C29H16F4INO5 — CID 145100592
1-O-[4-(4-cyanophenyl)phenyl] 3-O-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl] 2-iodopropanedioate (PubChem CID 145100592) has the molecular formula C29H16F4INO5 and a molecular weight of 661.35 g/mol. Its IUPAC name is 1-O-[4-(4-cyanophenyl)phenyl] 3-O-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl] 2-iodopropanedioate.
| Compound Name | 1-O-[4-(4-cyanophenyl)phenyl] 3-O-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl] 2-iodopropanedioate |
|---|---|
| PubChem CID | 145100592 |
| Molecular Formula | C29H16F4INO5 |
| Molecular Weight | 661.35 g/mol |
| Exact Mass | 661.00 |
| IUPAC Name | 1-O-[4-(4-cyanophenyl)phenyl] 3-O-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl] 2-iodopropanedioate |
| SMILES | N#Cc1ccc(-c2ccc(OC(=O)C(I)C(=O)Oc3ccc(-c4ccc(OC(F)(F)F)cc4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C29H16F4INO5/c30-25-15-23(13-14-24(25)20-7-11-22(12-8-20)40-29(31,32)33)39-28(37)26(34)27(36)38-21-9-5-19(6-10-21)18-3-1-17(16-35)2-4-18/h1-15,26H |
| InChIKey | XJMDYFYBVWSXKS-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.35 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|