C23H14F4O2 — CID 89134846
[4-(3,5-difluoro-4-prop-1-ynylphenyl)-3-fluorophenyl] 2-fluoro-4-methylbenzoate (PubChem CID 89134846) has the molecular formula C23H14F4O2 and a molecular weight of 398.36 g/mol. Its IUPAC name is [4-(3,5-difluoro-4-prop-1-ynylphenyl)-3-fluorophenyl] 2-fluoro-4-methylbenzoate.
| Compound Name | [4-(3,5-difluoro-4-prop-1-ynylphenyl)-3-fluorophenyl] 2-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 89134846 |
| Molecular Formula | C23H14F4O2 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [4-(3,5-difluoro-4-prop-1-ynylphenyl)-3-fluorophenyl] 2-fluoro-4-methylbenzoate |
| SMILES | CC#Cc1c(F)cc(-c2ccc(OC(=O)c3ccc(C)cc3F)cc2F)cc1F |
| InChI | InChI=1S/C23H14F4O2/c1-3-4-17-20(25)10-14(11-21(17)26)16-8-6-15(12-22(16)27)29-23(28)18-7-5-13(2)9-19(18)24/h5-12H,1-2H3 |
| InChIKey | MCBYRMHPGNOUDA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|