C22H10F7IOS — CID 145389469
2-[4-[[2,6-difluoro-4-(2-fluoro-4-methylphenyl)phenyl]-difluoromethoxy]-2,6-difluorophenyl]ethynyl thiohypoiodite (PubChem CID 145389469) has the molecular formula C22H10F7IOS and a molecular weight of 582.28 g/mol. Its IUPAC name is 2-[4-[[2,6-difluoro-4-(2-fluoro-4-methylphenyl)phenyl]-difluoromethoxy]-2,6-difluorophenyl]ethynyl thiohypoiodite.
| Compound Name | 2-[4-[[2,6-difluoro-4-(2-fluoro-4-methylphenyl)phenyl]-difluoromethoxy]-2,6-difluorophenyl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 145389469 |
| Molecular Formula | C22H10F7IOS |
| Molecular Weight | 582.28 g/mol |
| Exact Mass | 581.94 |
| IUPAC Name | 2-[4-[[2,6-difluoro-4-(2-fluoro-4-methylphenyl)phenyl]-difluoromethoxy]-2,6-difluorophenyl]ethynyl thiohypoiodite |
| SMILES | Cc1ccc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(C#CSI)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C22H10F7IOS/c1-11-2-3-14(16(23)6-11)12-7-19(26)21(20(27)8-12)22(28,29)31-13-9-17(24)15(4-5-32-30)18(25)10-13/h2-3,6-10H,1H3 |
| InChIKey | KDJBJRPHZNUNRG-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.28 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|