C12H14F3NO — CID 169474783
3-[2-methoxy-5-(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine (PubChem CID 169474783) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is 3-[2-methoxy-5-(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine.
| Compound Name | 3-[2-methoxy-5-(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 169474783 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 3-[2-methoxy-5-(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine |
| SMILES | CNCC=Cc1cc(C(F)(F)F)ccc1OC |
| InChI | InChI=1S/C12H14F3NO/c1-16-7-3-4-9-8-10(12(13,14)15)5-6-11(9)17-2/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | SRLMVSAWPOETFR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |