C21H18Cl5F2O5P — CID 53248038
(2,3,4,5,6-pentachlorophenyl) (E)-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]but-2-enoate (PubChem CID 53248038) has the molecular formula C21H18Cl5F2O5P and a molecular weight of 596.61 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) (E)-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]but-2-enoate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) (E)-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 53248038 |
| Molecular Formula | C21H18Cl5F2O5P |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 593.93 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) (E)-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]but-2-enoate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(/C(C)=C/C(=O)Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C21H18Cl5F2O5P/c1-4-31-34(30,32-5-2)21(27,28)13-8-6-12(7-9-13)11(3)10-14(29)33-20-18(25)16(23)15(22)17(24)19(20)26/h6-10H,4-5H2,1-3H3/b11-10+ |
| InChIKey | VGELMTJMBNLRTO-ZHACJKMWSA-N |
| XLogP | 9.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|