C16H8Cl5O4P — CID 86661714
(2,3,4,5,6-pentachlorophenyl) (E)-3-(4-phosphorosooxyphenyl)but-2-enoate (PubChem CID 86661714) has the molecular formula C16H8Cl5O4P and a molecular weight of 472.48 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) (E)-3-(4-phosphorosooxyphenyl)but-2-enoate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) (E)-3-(4-phosphorosooxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 86661714 |
| Molecular Formula | C16H8Cl5O4P |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 469.86 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) (E)-3-(4-phosphorosooxyphenyl)but-2-enoate |
| SMILES | C/C(=C\C(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)c1ccc(OP=O)cc1 |
| InChI | InChI=1S/C16H8Cl5O4P/c1-7(8-2-4-9(5-3-8)25-26-23)6-10(22)24-16-14(20)12(18)11(17)13(19)15(16)21/h2-6H,1H3/b7-6+ |
| InChIKey | VBHSDCFOXLKIHF-VOTSOKGWSA-N |
| XLogP | 7.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|