C16H23NO3 — CID 101142383
tert-butyl (E)-3-[4-(2-aminoethoxy)phenyl]but-2-enoate (PubChem CID 101142383) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-(2-aminoethoxy)phenyl]but-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-(2-aminoethoxy)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 101142383 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | tert-butyl (E)-3-[4-(2-aminoethoxy)phenyl]but-2-enoate |
| SMILES | C/C(=C\C(=O)OC(C)(C)C)c1ccc(OCCN)cc1 |
| InChI | InChI=1S/C16H23NO3/c1-12(11-15(18)20-16(2,3)4)13-5-7-14(8-6-13)19-10-9-17/h5-8,11H,9-10,17H2,1-4H3/b12-11+ |
| InChIKey | VXACERYPHGOQAH-VAWYXSNFSA-N |
| XLogP | 2.77 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|