C28H36O5 — CID 154344431
tert-butyl 3-[4-[4-(8-hydroxyoctoxy)benzoyl]phenyl]prop-2-enoate (PubChem CID 154344431) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is tert-butyl 3-[4-[4-(8-hydroxyoctoxy)benzoyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-[4-(8-hydroxyoctoxy)benzoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 154344431 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | tert-butyl 3-[4-[4-(8-hydroxyoctoxy)benzoyl]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1ccc(C(=O)c2ccc(OCCCCCCCCO)cc2)cc1 |
| InChI | InChI=1S/C28H36O5/c1-28(2,3)33-26(30)19-12-22-10-13-23(14-11-22)27(31)24-15-17-25(18-16-24)32-21-9-7-5-4-6-8-20-29/h10-19,29H,4-9,20-21H2,1-3H3 |
| InChIKey | DSVIXYZAJGXQCN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|