C17H21IO5 — CID 163788466
5-[4-[(E)-3-(2-iodopropan-2-yloxy)-3-oxoprop-1-enyl]phenoxy]pentanoic acid (PubChem CID 163788466) has the molecular formula C17H21IO5 and a molecular weight of 432.25 g/mol. Its IUPAC name is 5-[4-[(E)-3-(2-iodopropan-2-yloxy)-3-oxoprop-1-enyl]phenoxy]pentanoic acid.
| Compound Name | 5-[4-[(E)-3-(2-iodopropan-2-yloxy)-3-oxoprop-1-enyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 163788466 |
| Molecular Formula | C17H21IO5 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 5-[4-[(E)-3-(2-iodopropan-2-yloxy)-3-oxoprop-1-enyl]phenoxy]pentanoic acid |
| SMILES | CC(C)(I)OC(=O)/C=C/c1ccc(OCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C17H21IO5/c1-17(2,18)23-16(21)11-8-13-6-9-14(10-7-13)22-12-4-3-5-15(19)20/h6-11H,3-5,12H2,1-2H3,(H,19,20)/b11-8+ |
| InChIKey | MUPMXXGNTRIPSK-DHZHZOJOSA-N |
| XLogP | 4.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|