C23H37O4P — CID 11742195
(E)-1-(3,5-ditert-butylphenyl)-4-dimethoxyphosphoryl-4-methylhex-1-en-3-one (PubChem CID 11742195) has the molecular formula C23H37O4P and a molecular weight of 408.52 g/mol. Its IUPAC name is (E)-1-(3,5-ditert-butylphenyl)-4-dimethoxyphosphoryl-4-methylhex-1-en-3-one.
| Compound Name | (E)-1-(3,5-ditert-butylphenyl)-4-dimethoxyphosphoryl-4-methylhex-1-en-3-one |
|---|---|
| PubChem CID | 11742195 |
| Molecular Formula | C23H37O4P |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (E)-1-(3,5-ditert-butylphenyl)-4-dimethoxyphosphoryl-4-methylhex-1-en-3-one |
| SMILES | CCC(C)(C(=O)/C=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1)P(=O)(OC)OC |
| InChI | InChI=1S/C23H37O4P/c1-11-23(8,28(25,26-9)27-10)20(24)13-12-17-14-18(21(2,3)4)16-19(15-17)22(5,6)7/h12-16H,11H2,1-10H3/b13-12+ |
| InChIKey | RZWGFIHYNMWRLI-OUKQBFOZSA-N |
| XLogP | 6.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|