C20H30O3 — CID 88844437
methyl 3-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]prop-2-enoate (PubChem CID 88844437) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is methyl 3-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 88844437 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | methyl 3-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]prop-2-enoate |
| SMILES | CCC(C)(C)c1cc(C=CC(=O)OC)cc(C(C)(C)CC)c1O |
| InChI | InChI=1S/C20H30O3/c1-8-19(3,4)15-12-14(10-11-17(21)23-7)13-16(18(15)22)20(5,6)9-2/h10-13,22H,8-9H2,1-7H3 |
| InChIKey | HASXZGNAYVMKLN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|