C20H31O5P — CID 85115105
4-dimethoxyphosphoryl-1-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-4-methylpent-1-en-3-one (PubChem CID 85115105) has the molecular formula C20H31O5P and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-dimethoxyphosphoryl-1-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-4-methylpent-1-en-3-one.
| Compound Name | 4-dimethoxyphosphoryl-1-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 85115105 |
| Molecular Formula | C20H31O5P |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 4-dimethoxyphosphoryl-1-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-4-methylpent-1-en-3-one |
| SMILES | COP(=O)(OC)C(C)(C)C(=O)C=Cc1cc(C(C)C)c(O)c(C(C)C)c1 |
| InChI | InChI=1S/C20H31O5P/c1-13(2)16-11-15(12-17(14(3)4)19(16)22)9-10-18(21)20(5,6)26(23,24-7)25-8/h9-14,22H,1-8H3 |
| InChIKey | MYYZLFGAXNPMMG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|