C31H36O2 — CID 22557635
ethyl (E)-3-[3,5-bis(4-tert-butylphenyl)phenyl]prop-2-enoate (PubChem CID 22557635) has the molecular formula C31H36O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is ethyl (E)-3-[3,5-bis(4-tert-butylphenyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3,5-bis(4-tert-butylphenyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 22557635 |
| Molecular Formula | C31H36O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | ethyl (E)-3-[3,5-bis(4-tert-butylphenyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(-c2ccc(C(C)(C)C)cc2)cc(-c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C31H36O2/c1-8-33-29(32)18-9-22-19-25(23-10-14-27(15-11-23)30(2,3)4)21-26(20-22)24-12-16-28(17-13-24)31(5,6)7/h9-21H,8H2,1-7H3/b18-9+ |
| InChIKey | FSHAABGHHWFAQS-GIJQJNRQSA-N |
| XLogP | 8.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|