C32H41F4NO8P2S — CID 86605689
N,N-bis[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]-2-phenylethanesulfonamide (PubChem CID 86605689) has the molecular formula C32H41F4NO8P2S and a molecular weight of 737.69 g/mol. Its IUPAC name is N,N-bis[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]-2-phenylethanesulfonamide.
| Compound Name | N,N-bis[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 86605689 |
| Molecular Formula | C32H41F4NO8P2S |
| Molecular Weight | 737.69 g/mol |
| Exact Mass | 737.20 |
| IUPAC Name | N,N-bis[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]-2-phenylethanesulfonamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(CN(Cc2ccc(C(F)(F)P(=O)(OCC)OCC)cc2)S(=O)(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H41F4NO8P2S/c1-5-42-46(38,43-6-2)31(33,34)29-18-14-27(15-19-29)24-37(48(40,41)23-22-26-12-10-9-11-13-26)25-28-16-20-30(21-17-28)32(35,36)47(39,44-7-3)45-8-4/h9-21H,5-8,22-25H2,1-4H3 |
| InChIKey | AEHCPHSNTDSAMY-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.69 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|