C26H28ClF2N2O6PS — CID 86605700
2-[benzyl-[[3-chloro-4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]sulfamoyl]benzamide (PubChem CID 86605700) has the molecular formula C26H28ClF2N2O6PS and a molecular weight of 601.01 g/mol. Its IUPAC name is 2-[benzyl-[[3-chloro-4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]sulfamoyl]benzamide.
| Compound Name | 2-[benzyl-[[3-chloro-4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 86605700 |
| Molecular Formula | C26H28ClF2N2O6PS |
| Molecular Weight | 601.01 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | 2-[benzyl-[[3-chloro-4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]sulfamoyl]benzamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccccc2C(N)=O)cc1Cl |
| InChI | InChI=1S/C26H28ClF2N2O6PS/c1-3-36-38(33,37-4-2)26(28,29)22-15-14-20(16-23(22)27)18-31(17-19-10-6-5-7-11-19)39(34,35)24-13-9-8-12-21(24)25(30)32/h5-16H,3-4,17-18H2,1-2H3,(H2,30,32) |
| InChIKey | ZABKOJKORBPVKZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.01 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|