C23H29ClF2NO6PS — CID 58663122
[[2-chloro-4-[[cycloheptylmethyl-(2-methoxyphenyl)sulfonylamino]methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 58663122) has the molecular formula C23H29ClF2NO6PS and a molecular weight of 551.98 g/mol. Its IUPAC name is [[2-chloro-4-[[cycloheptylmethyl-(2-methoxyphenyl)sulfonylamino]methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-chloro-4-[[cycloheptylmethyl-(2-methoxyphenyl)sulfonylamino]methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 58663122 |
| Molecular Formula | C23H29ClF2NO6PS |
| Molecular Weight | 551.98 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | [[2-chloro-4-[[cycloheptylmethyl-(2-methoxyphenyl)sulfonylamino]methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | COc1ccccc1S(=O)(=O)N(Cc1ccc(C(F)(F)P(=O)(O)O)c(Cl)c1)CC1CCCCCC1 |
| InChI | InChI=1S/C23H29ClF2NO6PS/c1-33-21-10-6-7-11-22(21)35(31,32)27(15-17-8-4-2-3-5-9-17)16-18-12-13-19(20(24)14-18)23(25,26)34(28,29)30/h6-7,10-14,17H,2-5,8-9,15-16H2,1H3,(H2,28,29,30) |
| InChIKey | WLTYBKICLAEXEF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.98 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|