C17H29F2O4PSi — CID 134937653
2-[[3-[diethoxyphosphoryl(difluoro)methyl]phenyl]methoxy]ethyl-trimethylsilane (PubChem CID 134937653) has the molecular formula C17H29F2O4PSi and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[[3-[diethoxyphosphoryl(difluoro)methyl]phenyl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[diethoxyphosphoryl(difluoro)methyl]phenyl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 134937653 |
| Molecular Formula | C17H29F2O4PSi |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[[3-[diethoxyphosphoryl(difluoro)methyl]phenyl]methoxy]ethyl-trimethylsilane |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1cccc(COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C17H29F2O4PSi/c1-6-22-24(20,23-7-2)17(18,19)16-10-8-9-15(13-16)14-21-11-12-25(3,4)5/h8-10,13H,6-7,11-12,14H2,1-5H3 |
| InChIKey | MCQDPYROQRICAQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|