C32H40F2NO5P — CID 24824364
N-[3-[diethoxyphosphoryl(difluoro)methyl]phenyl]-4-(4-octoxyphenyl)benzamide (PubChem CID 24824364) has the molecular formula C32H40F2NO5P and a molecular weight of 587.64 g/mol. Its IUPAC name is N-[3-[diethoxyphosphoryl(difluoro)methyl]phenyl]-4-(4-octoxyphenyl)benzamide.
| Compound Name | N-[3-[diethoxyphosphoryl(difluoro)methyl]phenyl]-4-(4-octoxyphenyl)benzamide |
|---|---|
| PubChem CID | 24824364 |
| Molecular Formula | C32H40F2NO5P |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | N-[3-[diethoxyphosphoryl(difluoro)methyl]phenyl]-4-(4-octoxyphenyl)benzamide |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Nc3cccc(C(F)(F)P(=O)(OCC)OCC)c3)cc2)cc1 |
| InChI | InChI=1S/C32H40F2NO5P/c1-4-7-8-9-10-11-23-38-30-21-19-26(20-22-30)25-15-17-27(18-16-25)31(36)35-29-14-12-13-28(24-29)32(33,34)41(37,39-5-2)40-6-3/h12-22,24H,4-11,23H2,1-3H3,(H,35,36) |
| InChIKey | PFIPRZRQXHTJHG-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|