C12H14F3O4P — CID 87761081
ethoxy-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]phosphinic acid (PubChem CID 87761081) has the molecular formula C12H14F3O4P and a molecular weight of 310.21 g/mol. Its IUPAC name is ethoxy-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]phosphinic acid.
| Compound Name | ethoxy-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]phosphinic acid |
|---|---|
| PubChem CID | 87761081 |
| Molecular Formula | C12H14F3O4P |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | ethoxy-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]phosphinic acid |
| SMILES | CCOP(=O)(O)CC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3O4P/c1-2-19-20(17,18)8-11(16)7-9-4-3-5-10(6-9)12(13,14)15/h3-6H,2,7-8H2,1H3,(H,17,18) |
| InChIKey | CUXUSGADVRPUOC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|