C9H10F3O5P — CID 87797224
ethoxy-[2-oxo-2-[5-(trifluoromethyl)furan-2-yl]ethyl]phosphinic acid (PubChem CID 87797224) has the molecular formula C9H10F3O5P and a molecular weight of 286.14 g/mol. Its IUPAC name is ethoxy-[2-oxo-2-[5-(trifluoromethyl)furan-2-yl]ethyl]phosphinic acid.
| Compound Name | ethoxy-[2-oxo-2-[5-(trifluoromethyl)furan-2-yl]ethyl]phosphinic acid |
|---|---|
| PubChem CID | 87797224 |
| Molecular Formula | C9H10F3O5P |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | ethoxy-[2-oxo-2-[5-(trifluoromethyl)furan-2-yl]ethyl]phosphinic acid |
| SMILES | CCOP(=O)(O)CC(=O)c1ccc(C(F)(F)F)o1 |
| InChI | InChI=1S/C9H10F3O5P/c1-2-16-18(14,15)5-6(13)7-3-4-8(17-7)9(10,11)12/h3-4H,2,5H2,1H3,(H,14,15) |
| InChIKey | JBANRCNNFIBRRX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|