C15H16F3N2O4P — CID 87372060
[2-[1-benzyl-5-(trifluoromethyl)pyrazol-4-yl]-2-oxoethyl]-ethoxyphosphinic acid (PubChem CID 87372060) has the molecular formula C15H16F3N2O4P and a molecular weight of 376.27 g/mol. Its IUPAC name is [2-[1-benzyl-5-(trifluoromethyl)pyrazol-4-yl]-2-oxoethyl]-ethoxyphosphinic acid.
| Compound Name | [2-[1-benzyl-5-(trifluoromethyl)pyrazol-4-yl]-2-oxoethyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 87372060 |
| Molecular Formula | C15H16F3N2O4P |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [2-[1-benzyl-5-(trifluoromethyl)pyrazol-4-yl]-2-oxoethyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)CC(=O)c1cnn(Cc2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C15H16F3N2O4P/c1-2-24-25(22,23)10-13(21)12-8-19-20(14(12)15(16,17)18)9-11-6-4-3-5-7-11/h3-8H,2,9-10H2,1H3,(H,22,23) |
| InChIKey | MOLOVSWHHGWYHM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|