C14H15F6O4P — CID 132517919
1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-3-(3-methylphenyl)propan-2-one (PubChem CID 132517919) has the molecular formula C14H15F6O4P and a molecular weight of 392.23 g/mol. Its IUPAC name is 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-3-(3-methylphenyl)propan-2-one.
| Compound Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-3-(3-methylphenyl)propan-2-one |
|---|---|
| PubChem CID | 132517919 |
| Molecular Formula | C14H15F6O4P |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-3-(3-methylphenyl)propan-2-one |
| SMILES | Cc1cccc(CC(=O)CP(=O)(OCC(F)(F)F)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F6O4P/c1-10-3-2-4-11(5-10)6-12(21)7-25(22,23-8-13(15,16)17)24-9-14(18,19)20/h2-5H,6-9H2,1H3 |
| InChIKey | OWFBSVNEEBLUCD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|