C22H18F3NO3 — CID 161210544
N-[4-[3-(3-methylphenyl)-2-oxopropyl]-2-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 161210544) has the molecular formula C22H18F3NO3 and a molecular weight of 401.38 g/mol. Its IUPAC name is N-[4-[3-(3-methylphenyl)-2-oxopropyl]-2-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[3-(3-methylphenyl)-2-oxopropyl]-2-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 161210544 |
| Molecular Formula | C22H18F3NO3 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[4-[3-(3-methylphenyl)-2-oxopropyl]-2-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1cccc(CC(=O)Cc2ccc(NC(=O)c3ccco3)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H18F3NO3/c1-14-4-2-5-15(10-14)11-17(27)12-16-7-8-19(18(13-16)22(23,24)25)26-21(28)20-6-3-9-29-20/h2-10,13H,11-12H2,1H3,(H,26,28) |
| InChIKey | UWEDSIQOIAJUIV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |