C23H17F3N2O5 — CID 26062121
methyl 4-[(E)-3-[4-(furan-2-carbonylamino)-2-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]benzoate (PubChem CID 26062121) has the molecular formula C23H17F3N2O5 and a molecular weight of 458.39 g/mol. Its IUPAC name is methyl 4-[(E)-3-[4-(furan-2-carbonylamino)-2-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[4-(furan-2-carbonylamino)-2-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 26062121 |
| Molecular Formula | C23H17F3N2O5 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | methyl 4-[(E)-3-[4-(furan-2-carbonylamino)-2-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)Nc2ccc(NC(=O)c3ccco3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N2O5/c1-32-22(31)15-7-4-14(5-8-15)6-11-20(29)28-18-10-9-16(13-17(18)23(24,25)26)27-21(30)19-3-2-12-33-19/h2-13H,1H3,(H,27,30)(H,28,29)/b11-6+ |
| InChIKey | YIJWNSBZJNQVEI-IZZDOVSWSA-N |
| XLogP | 4.99 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|