C24H20F4N2O2 — CID 148858620
1-(4-fluorophenyl)-3-[4-[3-(3-methylphenyl)-2-oxopropyl]-2-(trifluoromethyl)phenyl]urea (PubChem CID 148858620) has the molecular formula C24H20F4N2O2 and a molecular weight of 444.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[3-(3-methylphenyl)-2-oxopropyl]-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[3-(3-methylphenyl)-2-oxopropyl]-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 148858620 |
| Molecular Formula | C24H20F4N2O2 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[3-(3-methylphenyl)-2-oxopropyl]-2-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cccc(CC(=O)Cc2ccc(NC(=O)Nc3ccc(F)cc3)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C24H20F4N2O2/c1-15-3-2-4-16(11-15)12-20(31)13-17-5-10-22(21(14-17)24(26,27)28)30-23(32)29-19-8-6-18(25)7-9-19/h2-11,14H,12-13H2,1H3,(H2,29,30,32) |
| InChIKey | OYWKFIDGWYTZOS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |