C25H26O5 — CID 142702243
diethyl 2-but-3-enyl-2-[3-(2-formylnaphthalen-1-yl)prop-2-ynyl]propanedioate (PubChem CID 142702243) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is diethyl 2-but-3-enyl-2-[3-(2-formylnaphthalen-1-yl)prop-2-ynyl]propanedioate.
| Compound Name | diethyl 2-but-3-enyl-2-[3-(2-formylnaphthalen-1-yl)prop-2-ynyl]propanedioate |
|---|---|
| PubChem CID | 142702243 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | diethyl 2-but-3-enyl-2-[3-(2-formylnaphthalen-1-yl)prop-2-ynyl]propanedioate |
| SMILES | C=CCCC(CC#Cc1c(C=O)ccc2ccccc12)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H26O5/c1-4-7-16-25(23(27)29-5-2,24(28)30-6-3)17-10-13-22-20(18-26)15-14-19-11-8-9-12-21(19)22/h4,8-9,11-12,14-15,18H,1,5-7,16-17H2,2-3H3 |
| InChIKey | PAUUYQNPDDGODI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|