C25H30O6 — CID 54517945
diethyl 2-(naphthalen-1-ylmethyl)-2-[2-(oxan-4-yl)-2-oxoethyl]propanedioate (PubChem CID 54517945) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is diethyl 2-(naphthalen-1-ylmethyl)-2-[2-(oxan-4-yl)-2-oxoethyl]propanedioate.
| Compound Name | diethyl 2-(naphthalen-1-ylmethyl)-2-[2-(oxan-4-yl)-2-oxoethyl]propanedioate |
|---|---|
| PubChem CID | 54517945 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | diethyl 2-(naphthalen-1-ylmethyl)-2-[2-(oxan-4-yl)-2-oxoethyl]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)C1CCOCC1)(Cc1cccc2ccccc12)C(=O)OCC |
| InChI | InChI=1S/C25H30O6/c1-3-30-23(27)25(24(28)31-4-2,17-22(26)19-12-14-29-15-13-19)16-20-10-7-9-18-8-5-6-11-21(18)20/h5-11,19H,3-4,12-17H2,1-2H3 |
| InChIKey | YNSDRZKIHXZLCY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|