C32H40O12 — CID 139792037
triethyl 2-[8-[3-ethoxy-2,2-bis(ethoxycarbonyl)-3-oxopropyl]naphthalen-1-yl]ethane-1,1,1-tricarboxylate (PubChem CID 139792037) has the molecular formula C32H40O12 and a molecular weight of 616.66 g/mol. Its IUPAC name is triethyl 2-[8-[3-ethoxy-2,2-bis(ethoxycarbonyl)-3-oxopropyl]naphthalen-1-yl]ethane-1,1,1-tricarboxylate.
| Compound Name | triethyl 2-[8-[3-ethoxy-2,2-bis(ethoxycarbonyl)-3-oxopropyl]naphthalen-1-yl]ethane-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 139792037 |
| Molecular Formula | C32H40O12 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | triethyl 2-[8-[3-ethoxy-2,2-bis(ethoxycarbonyl)-3-oxopropyl]naphthalen-1-yl]ethane-1,1,1-tricarboxylate |
| SMILES | CCOC(=O)C(Cc1cccc2cccc(CC(C(=O)OCC)(C(=O)OCC)C(=O)OCC)c12)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C32H40O12/c1-7-39-25(33)31(26(34)40-8-2,27(35)41-9-3)19-22-17-13-15-21-16-14-18-23(24(21)22)20-32(28(36)42-10-4,29(37)43-11-5)30(38)44-12-6/h13-18H,7-12,19-20H2,1-6H3 |
| InChIKey | QCTAMHYCFQPNLJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|