C13H13F3N2O3 — CID 134821319
ethyl 2-(5-amino-1H-indol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 134821319) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is ethyl 2-(5-amino-1H-indol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl 2-(5-amino-1H-indol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 134821319 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | ethyl 2-(5-amino-1H-indol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(O)(c1c[nH]c2ccc(N)cc12)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O3/c1-2-21-11(19)12(20,13(14,15)16)9-6-18-10-4-3-7(17)5-8(9)10/h3-6,18,20H,2,17H2,1H3 |
| InChIKey | JOGIKBQGNVKAQB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|