C14H13ClF3NO3 — CID 23237339
ethyl 3-(5-chloro-1H-indol-3-yl)-4,4,4-trifluoro-3-hydroxybutanoate (PubChem CID 23237339) has the molecular formula C14H13ClF3NO3 and a molecular weight of 335.71 g/mol. Its IUPAC name is ethyl 3-(5-chloro-1H-indol-3-yl)-4,4,4-trifluoro-3-hydroxybutanoate.
| Compound Name | ethyl 3-(5-chloro-1H-indol-3-yl)-4,4,4-trifluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 23237339 |
| Molecular Formula | C14H13ClF3NO3 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | ethyl 3-(5-chloro-1H-indol-3-yl)-4,4,4-trifluoro-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)(c1c[nH]c2ccc(Cl)cc12)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3NO3/c1-2-22-12(20)6-13(21,14(16,17)18)10-7-19-11-4-3-8(15)5-9(10)11/h3-5,7,19,21H,2,6H2,1H3 |
| InChIKey | PERFKKGDTFEXKQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |