C19H17F3N2O3 — CID 151059968
ethyl 2-[4-amino-3-(1H-indol-2-yl)phenyl]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 151059968) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is ethyl 2-[4-amino-3-(1H-indol-2-yl)phenyl]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl 2-[4-amino-3-(1H-indol-2-yl)phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 151059968 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | ethyl 2-[4-amino-3-(1H-indol-2-yl)phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(O)(c1ccc(N)c(-c2cc3ccccc3[nH]2)c1)C(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O3/c1-2-27-17(25)18(26,19(20,21)22)12-7-8-14(23)13(10-12)16-9-11-5-3-4-6-15(11)24-16/h3-10,24,26H,2,23H2,1H3 |
| InChIKey | MFYNTZGONDORJW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|