C22H19ClN2O6 — CID 168518930
diethyl 2-[[4-chloro-2-(1,3-dioxoisoindol-2-yl)anilino]methylidene]propanedioate (PubChem CID 168518930) has the molecular formula C22H19ClN2O6 and a molecular weight of 442.86 g/mol. Its IUPAC name is diethyl 2-[[4-chloro-2-(1,3-dioxoisoindol-2-yl)anilino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[4-chloro-2-(1,3-dioxoisoindol-2-yl)anilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 168518930 |
| Molecular Formula | C22H19ClN2O6 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | diethyl 2-[[4-chloro-2-(1,3-dioxoisoindol-2-yl)anilino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1ccc(Cl)cc1N1C(=O)c2ccccc2C1=O)C(=O)OCC |
| InChI | InChI=1S/C22H19ClN2O6/c1-3-30-21(28)16(22(29)31-4-2)12-24-17-10-9-13(23)11-18(17)25-19(26)14-7-5-6-8-15(14)20(25)27/h5-12,24H,3-4H2,1-2H3 |
| InChIKey | YRMSQXGZLJOMHS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|